2,4,6-Trinitro-N-(4-methoxyphenyl)aniline structure
|
Common Name | 2,4,6-Trinitro-N-(4-methoxyphenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 16552-39-9 | Molecular Weight | 334.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methoxyphenyl)-2,4,6-trinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N4O7 |
|---|---|
| Molecular Weight | 334.24100 |
| Exact Mass | 334.05500 |
| PSA | 158.72000 |
| LogP | 4.80600 |
| InChIKey | AUASAZDUSWQUKB-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pikryl-p-anisidin |
| 2,4,6-trinitro-4'-methoxydiphenylamine |
| 2,4,6-Trinitro-N-(4-methoxyphenyl)aniline |
| Benzenamine,N-(4-methoxyphenyl)-2,4,6-trinitro |
| (4-methoxy-phenyl)-picryl-amine |
| 1-(p-Methoxy)phenylamino-2,4,6-trinitrobenzene |
| 2-Methoxy-2',4',6'-trinitro-diphenylamin |
| (4-Methoxy-phenyl)-picryl-amin |
| 2'.4'.6'-Trinitro-4-methoxy-diphenylamin |