Ethyl 7-chloro-4-hydroxy-3-quinolinecarboxylate structure
|
Common Name | Ethyl 7-chloro-4-hydroxy-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 16600-22-9 | Molecular Weight | 251.666 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 366.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6±26.5 °C | |
| Name | ethyl 7-chloro-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.8±37.0 °C at 760 mmHg |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.666 |
| Flash Point | 175.6±26.5 °C |
| Exact Mass | 251.034927 |
| PSA | 59.42000 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | XWMCHSWUDMFGSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2cc(Cl)ccc2c1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-CHLORO-4-HYDROXY-QUINOLINE-3-CARBOXYLIC ACID METHYL ESTER |
| 3-Quinolinecarboxylic acid, 7-chloro-4-hydroxy-, ethyl ester |
| 7-Chlor-4-hydroxy-chinolin-3-carbonsaeure-aethylester |
| Ethyl 7-chloro-4-hydroxy-3-quinolinecarboxylate |
| ethyl 7-chloro-4-hydroxy-3-quinoline-carboxylate |
| 7-chloro-4-hydroxy-quinoline-3-carboxylic acid ethyl ester |
| 7-Chlor-4-hydroxy-chinolin-3-carbonsaeure-ethylester |
| ethyl 7-chloro-4-hydroxyquinoline-3-carboxylate |