USAF LA-6 structure
|
Common Name | USAF LA-6 | ||
|---|---|---|---|---|
| CAS Number | 16603-03-5 | Molecular Weight | 200.70800 | |
| Density | N/A | Boiling Point | 307.4ºC at 760mmHg | |
| Molecular Formula | C10H17ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | [1-(2-methylphenyl)propan-2-ylamino]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 307.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.70800 |
| Flash Point | 163ºC |
| Exact Mass | 200.10800 |
| PSA | 38.05000 |
| LogP | 3.28250 |
| Vapour Pressure | 0.000727mmHg at 25°C |
| InChIKey | DPNVTTNDRDMESP-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CC(C)N[NH3+].[Cl-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (1-Methyl-2-o-tolyl-aethyl)-hydrazin |
| USAF LA-6 |
| 1-(2'-Methyl)phenyl-2-hydrazinopropane hydrochloride |
| [1-(2-methylphenyl)propan-2-ylamino]azanium chloride |
| 2-Methylphenyl-2-hydrazinopropan |
| (1-methyl-2-o-tolyl-ethyl)-hydrazine |