1H,1H,5H-Perfluoropentyl-1,1,2,2-tetrafluoroethylether structure
|
Common Name | 1H,1H,5H-Perfluoropentyl-1,1,2,2-tetrafluoroethylether | ||
|---|---|---|---|---|
| CAS Number | 16627-71-7 | Molecular Weight | 332.08700 | |
| Density | 1.532 g/cm3 | Boiling Point | 133ºC | |
| Molecular Formula | C7H4F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 45.037ºC | |
| Name | 1,1,2,2,3,3,4,4-octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532 g/cm3 |
|---|---|
| Boiling Point | 133ºC |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.08700 |
| Flash Point | 45.037ºC |
| Exact Mass | 332.00700 |
| PSA | 9.23000 |
| LogP | 4.03190 |
| Vapour Pressure | 7.42mmHg at 25°C |
| Index of Refraction | 1.279 |
| InChIKey | ZNBGTBKGFZMWKR-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | 3271.0 |
| Hazard Class | 3.0 |
| HS Code | 2909199090 |
|
~%
1H,1H,5H-Perflu... CAS#:16627-71-7 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 37, p. 847 - 852,797 - 801 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00155904 |
| 1H,1H,5H-Octafluoropentyl 1,1,2,2-Tetrafluoroethyl Ether |
| 1,1,2,2,3,3,4,4-Octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |