5-bromo-3-nitrosalicylaldehyde 97 structure
|
Common Name | 5-bromo-3-nitrosalicylaldehyde 97 | ||
|---|---|---|---|---|
| CAS Number | 16634-88-1 | Molecular Weight | 246.01500 | |
| Density | 1.928g/cm3 | Boiling Point | 265.8ºC at 760mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 125-127ºC | |
| MSDS | Chinese USA | Flash Point | 114.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Bromo-2-hydroxy-3-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.928g/cm3 |
|---|---|
| Boiling Point | 265.8ºC at 760mmHg |
| Melting Point | 125-127ºC |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.01500 |
| Flash Point | 114.6ºC |
| Exact Mass | 244.93200 |
| PSA | 83.12000 |
| LogP | 2.39860 |
| Vapour Pressure | 0.00546mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | YEYPSUQQZNDKDE-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Br)cc([N+](=O)[O-])c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2913000090 |
|
~97%
5-bromo-3-nitro... CAS#:16634-88-1 |
| Literature: Heinrich, Markus R.; Steglich, Wolfgang; Banwell, Martin G.; Kashman, Yoel Tetrahedron, 2003 , vol. 59, # 46 p. 9239 - 9247 |
|
~%
5-bromo-3-nitro... CAS#:16634-88-1 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 31, p. 56 - 58 |
|
~%
5-bromo-3-nitro... CAS#:16634-88-1 |
| Literature: Tetrahedron, , vol. 25, p. 3251 - 3266 |
|
~%
5-bromo-3-nitro... CAS#:16634-88-1 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 3, # 9 p. 1608 - 1613,1566 - 1569 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Salicylaldehyde,5-bromo-3-nitro |
| 5-Brom-2-hydroxy-3-nitro-benzaldehyd |
| 5-Bromo-2-hydroxy-3-nitro-benzaldehyde |
| 3-nitro-5-bromosalicylaldehyde |
| Benzaldehyde,5-bromo-2-hydroxy-3-nitro |
| 5-BroMo-3-nitrosalicylaldehyde |
| MFCD00130110 |