(1R,2R)-1,2-Diphenylethylenediamine structure
|
Common Name | (1R,2R)-1,2-Diphenylethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 16635-95-3 | Molecular Weight | 212.29 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 307.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2 | Melting Point | 123-125ºC(lit.) | |
| MSDS | N/A | Flash Point | 128.5±9.7 °C | |
| Name | 1,2-diphenylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.0±0.0 °C at 760 mmHg |
| Melting Point | 123-125ºC(lit.) |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| Flash Point | 128.5±9.7 °C |
| Exact Mass | 212.131348519 |
| PSA | 52.04000 |
| LogP | 4.83 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | PONXTPCRRASWKW-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)N)N |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S26-S36/37-S61 |
| RIDADR | UN 2735 |
| WGK Germany | 2 |
| RTECS | WJ4926500 |
| HS Code | 2921590090 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Ratio of Ki for rat brain NMDA receptor in presence of 100 uM spermine to Ki for rat ...
Source: ChEMBL
Target: Glutamate receptor ionotropic, NMDA 3A
External Id: CHEMBL978911
|
|
Name: Inhibition of DPP4 at 100 uM
Source: ChEMBL
Target: Dipeptidyl peptidase 4
External Id: CHEMBL862303
|
|
Name: Displacement of [3H]MK801 from NMDA receptor in rat brain neuronal membrane
Source: ChEMBL
Target: Glutamate receptor ionotropic, NMDA 3A
External Id: CHEMBL978910
|
| diphenylethylene |
| α-Methylene-diphenylmethane |
| STILBENE,TRANS |
| BIBENZAL |
| 1,1'-Ethenylidene bis-benzene |
| 1,1'-(E)-Ethene-1,2-diyldibenzene |
| Stilbene,(E) |
| (E)-stilbene |
| (1R,2R)-1,2-Diphenylethan-1,2-diamin |
| (1R,2R)-1,2-Diphenylethylenediamine |
| 1,2-Diphenylethylenediamine |
| cis-1,2-diphenylethylene |
| 1,1'-Ethene-1,2-diyldibenzene |
| (±)-1,2-Diamino-1,2-diphenylethane |
| E-stilbene |
| Bibenzil |
| (1R,2R)-(+)-1,2-Diphenylethylenediamine |
| trans-Stilbene |
| 1,1-Diphenylethene |
| 1,1'-Ethene-1,1-diyldibenzene |
| (1R,2R)-1,2-Diphenyl-1,2-ethanediamine |
| stilbene |
| 1,1-Diphenylethylene |
| α,α-Diphenylethylene |
| Dibenzal,(E) |
| Toluylene |
| trans-1,2-diphenylethylen |
| MFCD00064300 |
| )-1,2-Diphenylethylenediamine |
| (1R,2R)-rel-1,2-Diphenylethane-1,2-diamine |
| Bibenzylidene |
| 1,1'-[(E)-1,2-Ethenediyl]dibenzene |
| 1,1'-(1,2-ethenediyl)bis[benzene] |
| TRANS-A B-DIPHENYLETHYLENE |
| trans-bibenzal |
| α-Phenylstyrene |
| TRANS-BIBENZYLIDENE |
| trans-1,2-diphenylethylene |
| TRANS-TOLUYLENE |
| (1R,2R)-1,2-diphenylethane-1,2-diamine |
| EINECS 203-098-5 |
| 1,1'-(1,1-Ethenediyl)dibenzene |
| [E]-1,2-diphenylethene |
| 1,1'-(ethene-1,2-diyl)dibenzene |
| [(E)-2-phenylethenyl]benzene |
| (E)-1,2-diphenylethylene |
| (+/-)-1,2-DiphenylethylenediaMine |
| 1,2-diphenylethylene |
| 1,2-Dihydrostilbene |