9-amino-4-hydroxy-7-methylfuro[3,2-g]chromen-5-one structure
|
Common Name | 9-amino-4-hydroxy-7-methylfuro[3,2-g]chromen-5-one | ||
|---|---|---|---|---|
| CAS Number | 16639-42-2 | Molecular Weight | 231.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-amino-4-hydroxy-7-methylfuro[3,2-g]chromen-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9NO4 |
|---|---|
| Molecular Weight | 231.20400 |
| Exact Mass | 231.05300 |
| PSA | 89.60000 |
| LogP | 2.71660 |
| InChIKey | XXFUNNQZTHYWPP-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(O)c3ccoc3c(N)c2o1 |
|
~%
9-amino-4-hydro... CAS#:16639-42-2 |
| Literature: Schoenberg; Badran Journal of the American Chemical Society, 1951 , vol. 73, p. 2960 |
|
~%
9-amino-4-hydro... CAS#:16639-42-2 |
| Literature: Schoenberg; Badran Journal of the American Chemical Society, 1951 , vol. 73, p. 2960 |
|
~%
9-amino-4-hydro... CAS#:16639-42-2 |
| Literature: Schoenberg; Badran Journal of the American Chemical Society, 1951 , vol. 73, p. 2960 |
| 9-amino-4-hydroxy-7-methyl-furo[3,2-g]chromen-5-one |
| 9-Amino-desmethyl-visnagin |
| 5H-Furo[3,2-g][1]benzopyran-5-one,9-amino-4-hydroxy-7-methyl |