Phenol,3,4-dichloro-2,6-dinitro- structure
|
Common Name | Phenol,3,4-dichloro-2,6-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 1664-10-4 | Molecular Weight | 252.99600 | |
| Density | 1.867g/cm3 | Boiling Point | 281.8ºC at 760 mmHg | |
| Molecular Formula | C6H2Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2ºC | |
| Name | 3,4-dichloro-2,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.867g/cm3 |
|---|---|
| Boiling Point | 281.8ºC at 760 mmHg |
| Molecular Formula | C6H2Cl2N2O5 |
| Molecular Weight | 252.99600 |
| Flash Point | 124.2ºC |
| Exact Mass | 251.93400 |
| PSA | 111.87000 |
| LogP | 3.56180 |
| Vapour Pressure | 0.00204mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | CTCOFMWFBMXCCZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)c([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2(1H)-Quinolinone,3,4-dichloro-1-phenyl |
| 3,4-Dichlor-1-phenyl-2(1H)-chinolon |
| 3,4-Dichlor-2,6-dinitro-phenol |