Phenol,3-methyl-2,6-dinitro- structure
|
Common Name | Phenol,3-methyl-2,6-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 603-03-2 | Molecular Weight | 198.13300 | |
| Density | 1.55g/cm3 | Boiling Point | 266.7ºC at 760mmHg | |
| Molecular Formula | C7H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.7ºC | |
| Name | 3-methyl-2,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 266.7ºC at 760mmHg |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13300 |
| Flash Point | 115.7ºC |
| Exact Mass | 198.02800 |
| PSA | 111.87000 |
| LogP | 2.56340 |
| Index of Refraction | 1.639 |
| InChIKey | RXUSMLCMOQWNOQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(O)c1[N+](=O)[O-] |
|
~%
Phenol,3-methyl... CAS#:603-03-2 |
| Literature: Will Chemische Berichte, 1914 , vol. 47, p. 712 |
|
~%
Phenol,3-methyl... CAS#:603-03-2 |
| Literature: Chakravarti; Banerjee Journal of the Indian Chemical Society, 1936 , vol. 13, p. 619,624 |
|
~%
Phenol,3-methyl... CAS#:603-03-2 |
| Literature: Will Chemische Berichte, 1914 , vol. 47, p. 712 |
|
~%
Phenol,3-methyl... CAS#:603-03-2 |
| Literature: Nietzki; Ruppert Chemische Berichte, 1890 , vol. 23, p. 3479 |
| 2,6-Dinitro-3-methylphenol |
| Phenol,2-[(2-methyl-4,6-dinitrophenyl)amino] |
| 2,6-dinitro-m-cresol |
| 2,4-dinitrocresol |
| 2.6-Dinitro-m-kresol |
| 2.4-Dinitro-2'-hydroxy-6-methyl-diphenylamin |
| 4.6-dinitro-2'-oxy-2-methyl-diphenylamine |
| 2.4-Dinitro-3-oxy-1-methyl-benzol |
| 2.4-dinitro-3-hydroxy-toluene |
| 2.4-Dinitro-3-hydroxy-toluol |