(1-(4-Nitrophenyl)piperidin-3-yl)methanol structure
|
Common Name | (1-(4-Nitrophenyl)piperidin-3-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 166438-83-1 | Molecular Weight | 236.267 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 428.7±20.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | 99-100°C | |
| MSDS | N/A | Flash Point | 213.0±21.8 °C | |
| Name | (1-(4-Nitrophenyl)piperidin-3-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.7±20.0 °C at 760 mmHg |
| Melting Point | 99-100°C |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.267 |
| Flash Point | 213.0±21.8 °C |
| Exact Mass | 236.116089 |
| PSA | 69.29000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | GHESWKCVPRIYLS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC(CO)C2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Piperidinemethanol, 1-(4-nitrophenyl)- |
| [1-(4-Nitrophenyl)-3-piperidinyl]methanol |
| [1-(4-nitrophenyl)piperidin-3-yl]methanol |