4-(4-METHYL-1,4-DIAZEPAN-1-YL)BENZALDEHYDE 97 structure
|
Common Name | 4-(4-METHYL-1,4-DIAZEPAN-1-YL)BENZALDEHYDE 97 | ||
|---|---|---|---|---|
| CAS Number | 166438-86-4 | Molecular Weight | 218.29500 | |
| Density | 1.079g/cm3 | Boiling Point | 366.6ºC at 760mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | 44-46ºC | |
| MSDS | N/A | Flash Point | 160.1ºC | |
| Name | 4-(4-methyl-1,4-diazepan-1-yl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 366.6ºC at 760mmHg |
| Melting Point | 44-46ºC |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 160.1ºC |
| Exact Mass | 218.14200 |
| PSA | 23.55000 |
| LogP | 1.64390 |
| Vapour Pressure | 1.45E-05mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | MRMHNZCHZCRCAV-UHFFFAOYSA-N |
| SMILES | CN1CCCN(c2ccc(C=O)cc2)CC1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Formylphenyl)-4-methylhomopiperazine |