1H-Isoindole-1,3(2H)-dione,2-(phenylmethoxy)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(phenylmethoxy)- | ||
|---|---|---|---|---|
| CAS Number | 16653-19-3 | Molecular Weight | 253.25300 | |
| Density | 1.35g/cm3 | Boiling Point | 412.5ºC at 760mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 2-phenylmethoxyisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760mmHg |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 203.3ºC |
| Exact Mass | 253.07400 |
| PSA | 46.61000 |
| LogP | 2.35230 |
| Vapour Pressure | 5.14E-07mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | IOZADUIJKWISQS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1OCc1ccccc1 |
| HS Code | 2925190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-benzyloxyisoindole-1,3-dione |
| O-benzyl-N-hydroxyphthalimide |
| N-benzyloxyphthalimide |