Tricyclo[3.3.1.13,7]decane-1-aceticacid, a-chloro-3,5,7-trimethyl-
Modify Date: 2025-08-21 10:38:09
![Tricyclo[3.3.1.13,7]decane-1-aceticacid, a-chloro-3,5,7-trimethyl- Structure](https://image.chemsrc.com/caspic/162/16668-45-4.png)
Tricyclo[3.3.1.13,7]decane-1-aceticacid, a-chloro-3,5,7-trimethyl- structure
|
Common Name | Tricyclo[3.3.1.13,7]decane-1-aceticacid, a-chloro-3,5,7-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 16668-45-4 | Molecular Weight | 270.79500 | |
| Density | 1.23g/cm3 | Boiling Point | 354.6ºC at 760mmHg | |
| Molecular Formula | C15H23ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3ºC | |
| Name | 2-chloro-2-(3,5,7-trimethyl-1-adamantyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 354.6ºC at 760mmHg |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.79500 |
| Flash Point | 168.3ºC |
| Exact Mass | 270.13900 |
| PSA | 37.30000 |
| LogP | 4.06510 |
| Vapour Pressure | 5.53E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | AIPDCMZNOXKOBM-UHFFFAOYSA-N |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(Cl)C(=O)O)(C2)C3 |
| HS Code | 2916209090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:20138-01-6
CAS#:36094-50-5![Tricyclo[3.3.1.13,7]decane-1-acetamide,a-chloro-N-cyclohexyl-3,5,7-trimethyl- structure](https://image.chemsrc.com/caspic/288/36094-52-7.png)
CAS#:36094-52-7| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3.5.7-Trimethyl-1-adamantan-chloressigsaeure |