(tert-Butylamino)(3,5,7-trimethyl-1-adamantyl)acetic acid structure
|
Common Name | (tert-Butylamino)(3,5,7-trimethyl-1-adamantyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 20138-01-6 | Molecular Weight | 307.47100 | |
| Density | 1.084g/cm3 | Boiling Point | 390.2ºC at 760 mmHg | |
| Molecular Formula | C19H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
| Name | 2-(tert-butylamino)-2-(3,5,7-trimethyl-1-adamantyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760 mmHg |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.47100 |
| Flash Point | 189.8ºC |
| Exact Mass | 307.25100 |
| PSA | 49.33000 |
| LogP | 4.60530 |
| Vapour Pressure | 3.56E-07mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | BPSWQUUOJZGDMK-UHFFFAOYSA-N |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(NC(C)(C)C)C(=O)O)(C2)C3 |
| HS Code | 2922499990 |
|---|
|
~%
(tert-Butylamin... CAS#:20138-01-6 |
| Literature: Bott,K. Justus Liebigs Annalen der Chemie, 1972 , vol. 755, p. 58 - 66 |
|
~%
(tert-Butylamin... CAS#:20138-01-6 |
| Literature: Bott,K. Justus Liebigs Annalen der Chemie, 1972 , vol. 755, p. 58 - 66 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (tert-Butylamino)(3,5,7-trimethyl-1-adamantyl)acetic acid |
| N-tert.-Butyl-(3,5,7-trimethyladamantyl-(1))-aminoessigsaeure |