1-Piperazineethanol,4-(3-chlorophenyl)-a-(phenoxymethyl)- structure
|
Common Name | 1-Piperazineethanol,4-(3-chlorophenyl)-a-(phenoxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1668-42-4 | Molecular Weight | 346.85100 | |
| Density | 1.216g/cm3 | Boiling Point | 523.1ºC at 760 mmHg | |
| Molecular Formula | C19H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.2ºC | |
| Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-3-phenoxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 523.1ºC at 760 mmHg |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.85100 |
| Flash Point | 270.2ºC |
| Exact Mass | 346.14500 |
| PSA | 35.94000 |
| LogP | 2.90480 |
| Vapour Pressure | 9.02E-12mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | YFIBQIOYSRTVMO-UHFFFAOYSA-N |
| SMILES | OC(COc1ccccc1)CN1CCN(c2cccc(Cl)c2)CC1 |
|
~%
1-Piperazineeth... CAS#:1668-42-4 |
| Literature: Pollard; Fernandez Journal of Organic Chemistry, 1958 , vol. 23, p. 1935 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[4-(3-chloro-phenyl)-piperazino]-3-phenoxy-propan-2-ol |
| 1-[4-(3-chloro-phenyl)-piperazin-1-yl]-3-phenoxy-propan-2-ol |
| 1-[4-(3-Chlor-phenyl)-piperazino]-3-phenoxy-propan-2-ol |