2-(1-Boc-piperidin-4-ylmethyl)Malonic acid diethyl ester structure
|
Common Name | 2-(1-Boc-piperidin-4-ylmethyl)Malonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 166815-97-0 | Molecular Weight | 357.44200 | |
| Density | 1.087g/cm3 | Boiling Point | 417.7ºC at 760 mmHg | |
| Molecular Formula | C18H31NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | diethyl 2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]propanedioate |
|---|
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 417.7ºC at 760 mmHg |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.44200 |
| Flash Point | 206.4ºC |
| Exact Mass | 357.21500 |
| PSA | 82.14000 |
| LogP | 2.70390 |
| Vapour Pressure | 3.46E-07mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | WRRZIESILPEHHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OCC |
| HS Code | 2933399090 |
|---|
|
~%
2-(1-Boc-piperi... CAS#:166815-97-0 |
| Literature: Syntex (U.S.A.) Inc. Patent: US5763458 A1, 1998 ; US 5763458 A |
|
~88%
2-(1-Boc-piperi... CAS#:166815-97-0 |
| Literature: Merck and Co., Inc. Patent: US6265434 B1, 2001 ; US 6265434 B1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |