4-bromo-2,6-ditert-butyl-4-methylcyclohexa-2,5-dien-1-one structure
|
Common Name | 4-bromo-2,6-ditert-butyl-4-methylcyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 1669-36-9 | Molecular Weight | 299.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-2,6-ditert-butyl-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23BrO |
|---|---|
| Molecular Weight | 299.24700 |
| Exact Mass | 298.09300 |
| PSA | 17.07000 |
| LogP | 4.66770 |
| InChIKey | ZGVYNOZZVZIHAO-UHFFFAOYSA-N |
| SMILES | CC1(Br)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
|
~%
4-bromo-2,6-dit... CAS#:1669-36-9 |
| Literature: Coppinger; Campbell Journal of the American Chemical Society, 1953 , vol. 75, p. 734 |
|
~%
4-bromo-2,6-dit... CAS#:1669-36-9 |
| Literature: Kajigaeshi, Shoji; Morikawa, Yukihiro; Fujisaki, Shizuo; Kakinami, Takaaki; Nishihira, Keigo Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 3 p. 1060 - 1062 |
| 2,5-Cyclohexadien-1-one,4-bromo-2,6-bis(1,1-dimethylethyl)-4-methyl |
| 4-Brom-2,6-di-tert-butyl-4-methyl-cyclohexa-2,5-dienon |
| 4-bromo-2,6-di-tert-butyl-4-methyl-cyclohexa-2,5-dienone |