Benzenemethanol,3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 1-acetate structure
|
Common Name | Benzenemethanol,3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 14387-17-8 | Molecular Weight | 278.38700 | |
| Density | 1.015g/cm3 | Boiling Point | 322.2ºC at 760mmHg | |
| Molecular Formula | C17H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4ºC | |
| Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 322.2ºC at 760mmHg |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.38700 |
| Flash Point | 116.4ºC |
| Exact Mass | 278.18800 |
| PSA | 46.53000 |
| LogP | 4.05030 |
| Vapour Pressure | 0.000151mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | UJQUIYGYEMWYBS-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| HS Code | 2915390090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-Acetoxymethyl-2,6-di-tert-butyl-phenol |
| 3,5-Ditert-butyl-4-hydroxybenzyl acetate |
| 2,6-di-tert-butyl-4-acetoxymethylphenol |
| 3,4-di-tert-butyl-4-hydroxybenzyl acetate |