Acetic acid, 2-(4-acetyl-2-methylphenoxy)-, methyl ester structure
|
Common Name | Acetic acid, 2-(4-acetyl-2-methylphenoxy)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 166953-80-6 | Molecular Weight | 222.23700 | |
| Density | 1.124g/cm3 | Boiling Point | 344.938ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.167ºC | |
| Name | methyl 2-(4-acetyl-2-methylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 344.938ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 152.167ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.74940 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | CAOUTCDDAKSUJP-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1ccc(C(C)=O)cc1C |
|
~99%
Acetic acid, 2-... CAS#:166953-80-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 9 p. 1517 - 1521 |
| (4-acetyl-2-methyl-phenoxy)acetic acid methyl ester |
| Acetic acid,2-(4-acetyl-2-methylphenoxy)-,methyl ester |
| Acetic acid,(4-acetyl-2-methylphenoxy)-,methyl ester |
| methyl 4-acetyl-2-methylphenoxyacetate |