Methyl 6-amino-1H-indole-2-carboxylate structure
|
Common Name | Methyl 6-amino-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 167027-30-7 | Molecular Weight | 190.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 415.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.0±23.2 °C | |
| Name | methyl 6-amino-1h-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.4±25.0 °C at 760 mmHg |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.199 |
| Flash Point | 205.0±23.2 °C |
| Exact Mass | 190.074234 |
| PSA | 68.11000 |
| LogP | 1.29 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | PSEIRKHMARZIRI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccc(N)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~97%
Methyl 6-amino-... CAS#:167027-30-7 |
| Literature: US2004/63645 A1, ; Page/Page column 35; 52 ; |
|
~79%
Methyl 6-amino-... CAS#:167027-30-7 |
| Literature: WO2008/154271 A1, ; Page/Page column 136 ; |
|
~%
Methyl 6-amino-... CAS#:167027-30-7 |
| Literature: US2004/77646 A1, ; Page 93 ; |
|
~%
Methyl 6-amino-... CAS#:167027-30-7 |
| Literature: WO2008/154271 A1, ; |
|
~%
Methyl 6-amino-... CAS#:167027-30-7 |
| Literature: WO2008/154271 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 6-amino-, methyl ester |
| Methyl 6-amino-1H-indole-2-carboxylate |
| 6-amino-1H-indole-2-carboxylic acid methyl ester |
| RW3523 |
| 1H-Indole-2-carboxylic acid,6-amino-,methyl ester |