methyl 2-azidobenzoate structure
|
Common Name | methyl 2-azidobenzoate | ||
|---|---|---|---|---|
| CAS Number | 16714-23-1 | Molecular Weight | 177.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | -27.4 °F | |
| Symbol |
GHS02, GHS07, GHS08 |
Signal Word | Danger | |
| Name | Methyl 2-azidobenzoate solution |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7N3O2 |
|---|---|
| Molecular Weight | 177.16000 |
| Exact Mass | 177.05400 |
| PSA | 76.05000 |
| LogP | 1.86776 |
| InChIKey | LGHLODHMWICPLN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1N=[N+]=[N-] |
| Symbol |
GHS02, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315-H319-H372 |
| Precautionary Statements | P210-P305 + P351 + P338-P314 |
| RIDADR | UN 2398 3 / PGII |
| HS Code | 2929909090 |
| Flash Point(F) | -27.4 °F |
| Flash Point(C) | -33 °C |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Organic azides: an exploding diversity of a unique class of compounds.
Angew. Chem. Int. Ed. Engl. 44 , 5188-5240, (2005) Since the discovery of organic azides by Peter Griess more than 140 years ago, numerous syntheses of these energy-rich molecules have been developed. In more recent times in particular, completely new... |
| Methyl 2-azidobenzoate |