Butanamide,N-(5-chloro-2,4-dimethoxyphenyl)-3-oxo- structure
|
Common Name | Butanamide,N-(5-chloro-2,4-dimethoxyphenyl)-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 16715-80-3 | Molecular Weight | 271.69700 | |
| Density | 1.277g/cm3 | Boiling Point | 433.3ºC at 760mmHg | |
| Molecular Formula | C12H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760mmHg |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.69700 |
| Flash Point | 215.9ºC |
| Exact Mass | 271.06100 |
| PSA | 64.63000 |
| LogP | 2.34780 |
| Vapour Pressure | 1.04E-07mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | DUWWHGPELOTTOE-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(NC(=O)CC(C)=O)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetoacet-2,4-dimethoxy-5-chloroanilide |
| 5'-chloro-2',4'-dimethoxyacetoacetanilide |
| HMS2549O20 |