ethyl 2-[4-(2-bromoethyl)phenoxy]-2-methylpropanoate structure
|
Common Name | ethyl 2-[4-(2-bromoethyl)phenoxy]-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 167213-40-3 | Molecular Weight | 315.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[4-(2-bromoethyl)phenoxy]-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19BrO3 |
|---|---|
| Molecular Weight | 315.20300 |
| Exact Mass | 314.05200 |
| PSA | 35.53000 |
| LogP | 3.34450 |
| InChIKey | BSARASXZMNRHDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(CCBr)cc1 |
|
~96%
ethyl 2-[4-(2-b... CAS#:167213-40-3 |
| Literature: Bioorganic and medicinal chemistry, , vol. 9, # 12 p. 3265 - 3271 |
|
~%
ethyl 2-[4-(2-b... CAS#:167213-40-3 |
| Literature: US2003/166719 A1, ; |
|
~%
ethyl 2-[4-(2-b... CAS#:167213-40-3 |
| Literature: Bioorganic and medicinal chemistry, , vol. 9, # 12 p. 3265 - 3271 |
|
~%
ethyl 2-[4-(2-b... CAS#:167213-40-3 |
| Literature: Bioorganic and medicinal chemistry, , vol. 9, # 12 p. 3265 - 3271 |
| 2-[4-(2-bromoethyl)phenoxy]-2-methylpropionic ethyl ester |
| Propanoic acid,2-[4-(2-bromoethyl)phenoxy]-2-methyl-,ethyl ester |
| ethyl 2-[4-(2-bromoethyl)phenoxy]isobutyrate |
| ethyl 2-(4-(2-bromoethyl)phenoxy)-2-methylpropanoate |
| ethyl 2-[4-(2-bromoethyl)phenoxy]-2-methylpropionate |