2,4,6-Tribromophenyl caproate structure
|
Common Name | 2,4,6-Tribromophenyl caproate | ||
|---|---|---|---|---|
| CAS Number | 16732-09-5 | Molecular Weight | 428.94200 | |
| Density | 1.77 | Boiling Point | 400.1ºC at 760 mmHg | |
| Molecular Formula | C12H13Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
Use of 2,4,6-Tribromophenyl caproate2,4,6-Tribromophenyl caproate (2,4,6-tribromophenyl caproic acid ester) is an anti-fungal agent. |
| Name | (2,4,6-tribromophenyl) hexanoate |
|---|---|
| Synonym | More Synonyms |
| Description | 2,4,6-Tribromophenyl caproate (2,4,6-tribromophenyl caproic acid ester) is an anti-fungal agent. |
|---|---|
| Related Catalog | |
| Target |
anti-fungal[1] |
| In Vivo | 2,4,6-Tribromophenyl caproate (2,4,6-tribromophenyl caproic acid ester) contains at least one selected from Sharon skin or a salt thereof transdermal absorption patch according to any one of the first term through the fifth term[1]. |
| References |
[1]. Shusuke Ono, et al. Transdermal patch preparation. JP2002363070A. |
| Density | 1.77 |
|---|---|
| Boiling Point | 400.1ºC at 760 mmHg |
| Molecular Formula | C12H13Br3O2 |
| Molecular Weight | 428.94200 |
| Flash Point | 195.8ºC |
| Exact Mass | 425.84700 |
| PSA | 26.30000 |
| LogP | 5.45980 |
| Vapour Pressure | 1.31E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | WKADNUIXFNFRSW-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)Oc1c(Br)cc(Br)cc1Br |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2915900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Hexanoic Acid 2,4,6-Tribromophenyl Ester |
| WKADNUIXFNFRSW-UHFFFAOYSA |
| 2,4,6-Tribromphenol-caproat |
| 2,4,6-TribroMophenyl Hexanoate |
| 2,4,6-Tribromophenyl caproate |