Benzonitrile,4,4'-(1-methylethylidene)bis
Benzonitrile,4,4'-(1-methylethylidene)bis structure
|
Common Name | Benzonitrile,4,4'-(1-methylethylidene)bis | ||
|---|---|---|---|---|
| CAS Number | 1675-70-3 | Molecular Weight | 246.30600 | |
| Density | 1.12g/cm3 | Boiling Point | 414.8ºC at 760mmHg | |
| Molecular Formula | C17H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 414.8ºC at 760mmHg |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.30600 |
| Flash Point | 194.7ºC |
| Exact Mass | 246.11600 |
| PSA | 47.58000 |
| LogP | 3.75586 |
| Vapour Pressure | 4.33E-07mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | XWULMVRLWXONCN-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(C#N)cc1)c1ccc(C#N)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:544-92-3
CAS#:28139-76-6
CAS#:778-22-3![4-[2-(4-carboxyphenyl)propan-2-yl]benzoic acid structure](https://image.chemsrc.com/caspic/005/7425-84-5.png)
CAS#:7425-84-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-isopropylidene-di-benzonitrile |
| 2,2-Bis-(4-cyanophenyl)-propan |
| 2,2-bis(4-cyanophenyl)propane |
| 4,4'-propane-2,2-diyldibenzonitrile |
| 4,4'-Isopropyliden-di-benzonitril |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: The English name of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile. |
| Q: What is the CAS number of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: CAS number of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is 1675-70-3. |
| Q: What are the upstream materials of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: Related upstream materials(CAS) of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile: 544-92-3;28139-76-6;778-22-3. |
| Q: What are the downstream products of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: Related downstream products(CAS) of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile: 7425-84-5. |
| Q: What is the Chinese name of 1675-70-3? |
| A: Chinese name of 1675-70-3 is 1675-70-3. |
| Q: What is the polar surface area (PSA) of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: Polar surface area (PSA) of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is 47.58000. |
| Q: What is the boiling point of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: Boiling point of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is 414.8ºC at 760mmHg. |
| Q: What English synonyms does 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile have? |
| A: English synonyms of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile: 4,4'-isopropylidene-di-benzonitrile, 2,2-Bis-(4-cyanophenyl)-propan, 2,2-bis(4-cyanophenyl)propane, 4,4'-propane-2,2-diyldibenzonitrile, 4,4'-Isopropyliden-di-benzonitril. |
| Q: What is the InChIKey of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: InChIKey of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is XWULMVRLWXONCN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile? |
| A: SMILES notation of 4-[2-(4-cyanophenyl)propan-2-yl]benzonitrile is CC(C)(c1ccc(C#N)cc1)c1ccc(C#N)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |