Orthoformic acid triisobutyl ester
Orthoformic acid triisobutyl ester structure
|
Common Name | Orthoformic acid triisobutyl ester | ||
|---|---|---|---|---|
| CAS Number | 16754-49-7 | Molecular Weight | 232.36000 | |
| Density | N/A | Boiling Point | 314.53 °C (rough estimate) | |
| Molecular Formula | C13H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 314.53 °C (rough estimate) |
|---|---|
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36000 |
| Exact Mass | 232.20400 |
| PSA | 27.69000 |
| LogP | 3.28780 |
| InChIKey | IVXPLWROXBUJSE-UHFFFAOYSA-N |
| SMILES | CC(C)COC(OCC(C)C)OCC(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Orthoformic aci... CAS#:16754-49-7 |
| Literature: Sah; Ma Journal of the American Chemical Society, 1932 , vol. 54, p. 2965 |
|
~%
Orthoformic aci... CAS#:16754-49-7 |
| Literature: Alexander; Busch Journal of the American Chemical Society, 1952 , vol. 74, p. 554 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tri-i-butylorthoformate |
| Orthoformic acid,triisobutyl ester |
| triisobutyl orthoformate |
| Orthoameisensaeure-triisobutylester |
| Propane,1,1',1''-[methylidynetris(oxy)]tris[2-methyl |
| 1,1',1''-[methylidynetris(oxy)]tris[2-methyl-propane] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: The English name of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane. |
| Q: What is the SMILES notation of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: SMILES notation of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is CC(C)COC(OCC(C)C)OCC(C)C. |
| Q: What is the LogP of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: LogP of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 3.28780. |
| Q: What is the polar surface area (PSA) of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: Polar surface area (PSA) of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 27.69000. |
| Q: What is the molecular weight of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: Molecular weight of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 232.36000. |
| Q: What is the CAS number of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: CAS number of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 16754-49-7. |
| Q: What English synonyms does 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane have? |
| A: English synonyms of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane: tri-i-butylorthoformate, Orthoformic acid,triisobutyl ester, triisobutyl orthoformate, Orthoameisensaeure-triisobutylester, Propane,1,1',1''-[methylidynetris(oxy)]tris[2-methyl, 1,1',1''-[methylidynetris(oxy)]tris[2-methyl-propane]. |
| Q: What is the molecular formula of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: Molecular formula of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is C13H28O3. |
| Q: What is the InChIKey of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: InChIKey of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is IVXPLWROXBUJSE-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane? |
| A: Boiling point of 1-[bis(2-methylpropoxy)methoxy]-2-methylpropane is 314.53 °C (rough estimate). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |