4'-ethoxyacetophenone structure
|
Common Name | 4'-ethoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 1676-39-7 | Molecular Weight | 164.20100 | |
| Density | 1.016g/cm3 | Boiling Point | 268-269ºC758 mm Hg(lit.) | |
| Molecular Formula | C10H12O2 | Melting Point | 37-39ºC(lit.) | |
| MSDS | N/A | Flash Point | >230 | |
| Name | 4'-ethoxyacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016g/cm3 |
|---|---|
| Boiling Point | 268-269ºC758 mm Hg(lit.) |
| Melting Point | 37-39ºC(lit.) |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20100 |
| Flash Point | >230 |
| Exact Mass | 164.08400 |
| PSA | 26.30000 |
| LogP | 2.28790 |
| Vapour Pressure | 0.00612mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | CFDIWWUEXXJKRD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)CCc2ccc(Cl)cc2)cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Chlorbenzoyl-essigsaeurehomoveratrylamid |
| 4-ETHOXYPHENYLETHANONE |
| p-Chloro-N-(3,4-dimethoxyphenethyl)hydrocinnamamide |
| P-ETHOXYACETOPHENONE |
| MFCD00009095 |
| 4-Chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenepropanamide |
| EINECS 216-825-6 |
| 4-ACETYLPHENETOLE |