4-acetamido-3-nitrobenzenesulfonyl chloride structure
|
Common Name | 4-acetamido-3-nitrobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 16761-19-6 | Molecular Weight | 278.67000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClN2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-acetamido-3-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7ClN2O5S |
|---|---|
| Molecular Weight | 278.67000 |
| Exact Mass | 277.97600 |
| PSA | 120.93000 |
| LogP | 3.73420 |
| InChIKey | TZPGXCIXSNEQRH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Cl)cc1[N+](=O)[O-] |
|
~%
4-acetamido-3-n... CAS#:16761-19-6 |
| Literature: Merck and Co., Inc. Patent: US3987199 A1, 1976 ; |
|
~17%
4-acetamido-3-n... CAS#:16761-19-6 |
| Literature: Rosevear, Judi; Wilshire, John F. K. Australian Journal of Chemistry, 1982 , vol. 35, # 8 p. 1727 - 1732 |
|
~%
4-acetamido-3-n... CAS#:16761-19-6 |
| Literature: Kermack; Spragg; Tebrich Journal of the Chemical Society, 1939 , p. 608 |
| 4-Acetylamino-3-nitro-benzolsulfonylchlorid |
| 3-Nitro-4-acetamino-benzol-sulfonylchlorid-(1) |
| 3-Nitro-4-acetamidobenzolsulfonylchlorid |
| 4-acetamido-3-nitrobenzene-1-sulfonyl chloride |
| 4-(ACETYLAMINO)-3-NITROBENZENESULFONYL CHLORIDE |
| Benzenesulfonyl chloride,4-(acetylamino)-3-nitro |
| 4-acetylamino-3-nitro-benzenesulphonyl chloride |