4-acetamido-2-methoxybenzenesulfonyl chloride structure
|
Common Name | 4-acetamido-2-methoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 16781-12-7 | Molecular Weight | 263.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-acetamido-2-methoxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10ClNO4S |
|---|---|
| Molecular Weight | 263.69800 |
| Exact Mass | 263.00200 |
| PSA | 84.34000 |
| LogP | 3.31140 |
| InChIKey | WLPIGZCIFTWOAN-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(C)=O)ccc1S(=O)(=O)Cl |
|
~%
4-acetamido-2-m... CAS#:16781-12-7 |
| Literature: Vyas et al. Journal of Scientific and Industrial Research, 1955 , vol. 14 C, p. 218,220 |
|
~%
4-acetamido-2-m... CAS#:16781-12-7 |
| Literature: Vyas et al. Journal of Scientific and Industrial Research, 1955 , vol. 14 C, p. 218,220 |
| 4-Acetamino-2-methoxybenzolsulfochlorid |
| 4-(acetylamino)-2-methoxybenzenesulfonyl chloride |
| Benzenesulfonyl chloride,4-(acetylamino)-2-methoxy |
| 4-Acetylamino-2-methoxy-benzolsulfonylchlorid |