2,4-dinitro-N-(oct-3-yn-2-ylideneamino)aniline structure
|
Common Name | 2,4-dinitro-N-(oct-3-yn-2-ylideneamino)aniline | ||
|---|---|---|---|---|
| CAS Number | 1679-34-1 | Molecular Weight | 304.30100 | |
| Density | 1.22g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C14H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 2,4-dinitro-N-[(Z)-oct-3-yn-2-ylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.30100 |
| Flash Point | 219ºC |
| Exact Mass | 304.11700 |
| PSA | 116.03000 |
| LogP | 4.60380 |
| Vapour Pressure | 6.9E-08mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | QQWZJYYNFKYSKE-UHFFFAOYSA-N |
| SMILES | CCCCC#CC(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
2,4-dinitro-N-(... CAS#:1679-34-1 |
| Literature: Bowden; Jones Journal of the Chemical Society, 1946 , p. 52 |
|
~%
2,4-dinitro-N-(... CAS#:1679-34-1 |
| Literature: Bowden; Jones Journal of the Chemical Society, 1946 , p. 52 |
|
~%
2,4-dinitro-N-(... CAS#:1679-34-1 |
| Literature: Bowden; Jones Journal of the Chemical Society, 1946 , p. 52 |
| oct-3-yn-2-one-(2,4-dinitro-phenylhydrazone) |
| Oct-3-in-2-on-(2,4-dinitro-phenylhydrazon) |
| Octen-(3)-saeure |
| Oct-3-en-saeure |
| Octenoicacid |
| Oct-2-en-saeure |
| TRANS-3-OCTENOIC ACID |
| 3-Octenoic acid,tech. |
| Octin-(3)-on-(2)-2.4-dinitro-phenylhydrazon |