Boc-O-Benzyl-D-threoninol structure
|
Common Name | Boc-O-Benzyl-D-threoninol | ||
|---|---|---|---|---|
| CAS Number | 168034-31-9 | Molecular Weight | 295.37400 | |
| Density | 1.089 g/cm3 | Boiling Point | 449.023ºC at 760 mmHg | |
| Molecular Formula | C16H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.361ºC | |
| Name | Boc-O-Benzyl-D-threoninol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089 g/cm3 |
|---|---|
| Boiling Point | 449.023ºC at 760 mmHg |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.37400 |
| Flash Point | 225.361ºC |
| Exact Mass | 295.17800 |
| PSA | 67.79000 |
| LogP | 2.86820 |
| Index of Refraction | 1.511 |
| InChIKey | RXDBGDZAKNELGW-JSGCOSHPSA-N |
| SMILES | CC(OCc1ccccc1)C(CO)NC(=O)OC(C)(C)C |
| Storage condition | Store at 0°C |
| Hazard Codes | T+ |
|---|
|
~%
Boc-O-Benzyl-D-... CAS#:168034-31-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 68, # 5 p. 1369 - 1377 |
|
~%
Boc-O-Benzyl-D-... CAS#:168034-31-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 68, # 5 p. 1369 - 1377 |
|
~%
Boc-O-Benzyl-D-... CAS#:168034-31-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 68, # 5 p. 1369 - 1377 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| tert-Butyl ((2S,3S)-3-(benzyloxy)-1-hydroxybutan-2-yl)carbamate |
| Boc-O-Benzyl-D-Threoninol |
| tert-Butyl,(2S,3S)-3-(benzyloxy)-1-hydroxybutan-2-yl)carbamate |
| Boc-D-Thr(Bzl)-ol |