4-Chloro-N,N-diisopropylpicolinamide structure
|
Common Name | 4-Chloro-N,N-diisopropylpicolinamide | ||
|---|---|---|---|---|
| CAS Number | 168428-76-0 | Molecular Weight | 240.72900 | |
| Density | 1.11g/cm3 | Boiling Point | 361.3ºC at 760mmHg | |
| Molecular Formula | C12H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-N,N-diisopropylpicolinamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 361.3ºC at 760mmHg |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.72900 |
| Flash Point | 172.3ºC |
| Exact Mass | 240.10300 |
| PSA | 33.20000 |
| LogP | 2.99400 |
| Vapour Pressure | 2.09E-05mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | VMNWYVODDVOFPF-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1cc(Cl)ccn1)C(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 22 |
| RIDADR | NONH for all modes of transport |
|
~94%
4-Chloro-N,N-di... CAS#:168428-76-0 |
| Literature: Sammakia, Tarek; Stangeland, Eric L; Whitcomb, Mark C Organic letters, 2002 , vol. 4, # 14 p. 2385 - 2388 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-chloro-N,N-di(propan-2-yl)pyridine-2-carboxamide |