Morelloflavone structure
|
Common Name | Morelloflavone | ||
|---|---|---|---|---|
| CAS Number | 16851-21-1 | Molecular Weight | 556.47300 | |
| Density | 1.681g/cm3 | Boiling Point | 922.7ºC at 760 mmHg | |
| Molecular Formula | C30H20O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.6ºC | |
Use of MorelloflavoneMorelloflavone has antioxidative, antiviral, and anti-inflammatory properties. |
| Name | (+)-morelloflavone |
|---|---|
| Synonym | More Synonyms |
| Description | Morelloflavone has antioxidative, antiviral, and anti-inflammatory properties. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.681g/cm3 |
|---|---|
| Boiling Point | 922.7ºC at 760 mmHg |
| Molecular Formula | C30H20O11 |
| Molecular Weight | 556.47300 |
| Flash Point | 310.6ºC |
| Exact Mass | 556.10100 |
| PSA | 198.12000 |
| LogP | 4.49940 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.789 |
| InChIKey | GFWPWSNIXRDQJC-LMSSTIIKSA-N |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)cc2)C1c1c(O)cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc12 |
| Storage condition | 2-8℃ |
| Levopropoxyphene HCl |
| D-propoxyphene |
| 2-Butanol,4-(dimethylamino)-3-methyl-1,2-diphenyl-,propionate (ester),hydrochloride,(L) |
| (2R,3S)-4-Dimethylamino-3-methyl-1,2-diphenyl-2-propionyloxy-butan,Hydrochlorid |
| L-Propoxyphene hydrochloride |
| (2R,3S)-4-dimethylamino-3-methyl-1,2-diphenyl-2-propionyloxy-butane,hydrochloride |
| (2R,3S)-5,7,4',5'',7'',3''',4'''-heptahydroxyflavanone[3,8'']flavone |
| Levopropoxyphene hydrochloride |
| morrelloflavone |
| 8-[(2S,3R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| [4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate hydrochloride |