Phenol,3,5-di-1-pyrrolidinyl- structure
|
Common Name | Phenol,3,5-di-1-pyrrolidinyl- | ||
|---|---|---|---|---|
| CAS Number | 16857-92-4 | Molecular Weight | 232.32100 | |
| Density | 1.207g/cm3 | Boiling Point | 352.3ºC at 760mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | 3,5-dipyrrolidin-1-ylcyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 352.3ºC at 760mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 147.3ºC |
| Exact Mass | 232.15800 |
| PSA | 23.55000 |
| LogP | 1.79440 |
| Vapour Pressure | 3.88E-05mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | YCEAUXSKAJXVNA-UHFFFAOYSA-N |
| SMILES | O=C1C=C(N2CCCC2)C=C(N2CCCC2)C1 |
|
~%
Phenol,3,5-di-1... CAS#:16857-92-4 |
| Literature: Highet, Robert J. Journal of Organic Chemistry, 1986 , vol. 51, # 16 p. 3231 - 3232 |
|
~%
Phenol,3,5-di-1... CAS#:16857-92-4 |
| Literature: Knoche, Wilhelm; Vogel, Siegmund Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 1937 - 1942 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-Dipyrrolidinylphenol |
| 3,5-di-pyrrolidin-1-yl-phenol |
| 3,5-Di(1-pyrrolidinyl)-2,4-cyclohexadien-1-one |
| 3,5-(dipyrrolidine-1-yl)phenol |
| 3.5-Dipyrrolidino-phenol |
| Phenol,3,5-di-1-pyrrolidinyl |