2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)naphthalene-1,4-diol structure
|
Common Name | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)naphthalene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 16869-68-4 | Molecular Weight | 452.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)naphthalene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H48O2 |
|---|---|
| Molecular Weight | 452.71200 |
| Exact Mass | 452.36500 |
| PSA | 40.46000 |
| LogP | 9.48730 |
| InChIKey | BUFJIHPUGZHTHL-UHFFFAOYSA-N |
| SMILES | CC(=CCc1c(C)c(O)c2ccccc2c1O)CCCC(C)CCCC(C)CCCC(C)C |
|
~%
2-methyl-3-(3,7... CAS#:16869-68-4 |
| Literature: Boullais, Claude; Delvallee, Jacques Journal of Labelled Compounds and Radiopharmaceuticals, 1998 , vol. 41, # 2 p. 115 - 120 |
| Dihydrovitamin K1 |
| 1,4-Naphthalenediol,2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl) |
| trans-1,4-Dihydro-vitamin K1(20) |