3,7-Dihydro-7-hydroxy-1H-purine-2,6-dione structure
|
Common Name | 3,7-Dihydro-7-hydroxy-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 16870-90-9 | Molecular Weight | 168.11000 | |
| Density | 2.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-oxido-3H-purin-3-ium-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.31g/cm3 |
|---|---|
| Molecular Formula | C5H4N4O3 |
| Molecular Weight | 168.11000 |
| Exact Mass | 168.02800 |
| PSA | 108.37000 |
| Index of Refraction | 1.991 |
| InChIKey | INDAQGIDBUPVSF-UHFFFAOYSA-O |
| SMILES | O=C1NC(=O)c2c(ncn2[O-])[NH2+]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Hydroxyxanthine |
| 1H-Purine-2,6-dione,3,7-dihydro-7-hydroxy |
| 2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-3-ium-7-olate |
| 7-Hydroxyxanthin |
| Xanthine 7-N-oxide |
| 7-hydroxy-3,7-dihydro-purine-2,6-dione |