CL-409822 structure
|
Common Name | CL-409822 | ||
|---|---|---|---|---|
| CAS Number | 102838-04-0 | Molecular Weight | 399.44 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H25N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CL-409822diuretic activity diuretic activity |
| Name | CL-409822 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.44 |
| Exact Mass | 399.190643 |
| LogP | 1.56 |
| Index of Refraction | 1.685 |
| InChIKey | WZZZFYKZFBQDSA-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2CC(O)COc1ccccc1 |
| 1H-Purine-2,6-dione, 3,7-dihydro-7-(2-hydroxy-3-phenoxypropyl)-3-methyl-8-(1-piperidinyl)- |
| 7-(2-Hydroxy-3-phenoxypropyl)-3-methyl-8-(1-piperidinyl)-3,7-dihydro-1H-purine-2,6-dione |