tris(2,3,4,5,6-pentafluorophenyl)alumane structure
|
Common Name | tris(2,3,4,5,6-pentafluorophenyl)alumane | ||
|---|---|---|---|---|
| CAS Number | 168704-96-9 | Molecular Weight | 531.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H3AlF15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(2,3,4,5,6-pentafluorophenyl)alumane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H3AlF15 |
|---|---|
| Molecular Weight | 531.17400 |
| Exact Mass | 530.98100 |
| LogP | 8.35170 |
| InChIKey | POHPFVPVRKJHCR-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Al](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
|
~10%
tris(2,3,4,5,6-... CAS#:168704-96-9 |
| Literature: Journal of Organometallic Chemistry, , vol. 690, # 26 p. 6263 - 6270 |
|
~%
tris(2,3,4,5,6-... CAS#:168704-96-9 |
| Literature: Journal of the American Chemical Society, , vol. 122, # 23 p. 5668 - 5669 |
| tris(perfluorophenyl)aluminum |
| Aluminum,tris(pentafluorophenyl) |
| tris(pentafluorophenyl)alane |
| tris(pentafluorophenyl)aluminum |
| tris(pentafluorophenyl)aluminium |