1,4-Cyclohexadiene-1,4-dicarboxylicacid, 2,5-dihydroxy-, 1,4-diethyl ester
Modify Date: 2025-09-13 13:43:57
1,4-Cyclohexadiene-1,4-dicarboxylicacid, 2,5-dihydroxy-, 1,4-diethyl ester structure
|
Common Name | 1,4-Cyclohexadiene-1,4-dicarboxylicacid, 2,5-dihydroxy-, 1,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16877-79-5 | Molecular Weight | 256.25200 | |
| Density | 1.341g/cm3 | Boiling Point | 422.2ºC at 760mmHg | |
| Molecular Formula | C12H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | diethyl 2,5-dihydroxycyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760mmHg |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25200 |
| Flash Point | 160.2ºC |
| Exact Mass | 256.09500 |
| PSA | 93.06000 |
| LogP | 1.53060 |
| Vapour Pressure | 6.74E-09mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | NSWNRIHCLWQMCD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(O)CC(C(=O)OCC)=C(O)C1 |
|
~82%
1,4-Cyclohexadi... CAS#:16877-79-5 |
| Literature: Zhang, Yawei; Christoffers, Jens Synthesis, 2007 , # 19 p. 3061 - 3067 |
|
~%
1,4-Cyclohexadi... CAS#:16877-79-5 |
| Literature: Madeja-Kotkowska,Z. Bulletin de l'Academie Polonaise des Sciences, Serie des Sciences Chimiques, 1974 , vol. 22, p. 365 - 375 |
CAS#:17658-02-5| 1,5-dihydroxy-1,4-cyclohexadiene |
| 2,5-bis[ethoxy(hydroxy)methylidene]cyclohexane-1,4-dione |
| diethyl 2,5-dioxo-1,4-cyclohexanedicarboxylate |
| Diethyl succinylsuccinate |
| Diaethylsuccinylsuccinsaeureester |
| 2.5-Dihydroxy-cyclohexadien-(1.4)-dicarbonsaeure-(1.4)-diaethylester |
| diethyl 2,5-dihydroxy-1,4-cyclohexadiene-1,4-dicarboxylate |
| diethyl ester of 1,4-dihydroxy-2,5-dicarboxy-1,4-cyclohexadiene |
| 1,4-Dihydroxycyclohexa-1,4-dien-2,5-dicarbonsaeurediaethylester |