3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione structure
|
Common Name | 3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 168900-02-5 | Molecular Weight | 325.12200 | |
| Density | 1.558g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H7Cl2FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,4-dichlorophenyl)-6-fluoro-1H-quinazoline-2,4-dione |
|---|
| Density | 1.558g/cm3 |
|---|---|
| Molecular Formula | C14H7Cl2FN2O2 |
| Molecular Weight | 325.12200 |
| Exact Mass | 323.98700 |
| PSA | 55.12000 |
| LogP | 3.53720 |
| Index of Refraction | 1.64 |
| InChIKey | WSABVXQKFNLRDA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccc(F)cc2c(=O)n1-c1ccc(Cl)cc1Cl |
| Hazard Codes | N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 50/53 |
| Safety Phrases | 60-61 |