5-Aminoisatoic anhydride
5-Aminoisatoic anhydride structure
|
Common Name | 5-Aminoisatoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 169037-24-5 | Molecular Weight | 178.14500 | |
| Density | 1.501g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O3 | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Aminoisatoic anhydride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.501g/cm3 |
|---|---|
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.14500 |
| Exact Mass | 178.03800 |
| PSA | 89.09000 |
| LogP | 0.64470 |
| Index of Refraction | 1.65 |
| InChIKey | QEQDLBKVHJXPJA-UHFFFAOYSA-N |
| SMILES | Nc1ccc2[nH]c(=O)oc(=O)c2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H317-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:4693-02-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Amino-1H-benzo[d][1,3]oxazine-2,4-dione |
| 5-AMINOISATOIC ANHYDRIDE |
| MFCD00060534 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Aminoisatoic anhydride? |
| A: InChIKey of 5-Aminoisatoic anhydride is QEQDLBKVHJXPJA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-Aminoisatoic anhydride? |
| A: SMILES notation of 5-Aminoisatoic anhydride is Nc1ccc2[nH]c(=O)oc(=O)c2c1. |
| Q: What is the LogP of 5-Aminoisatoic anhydride? |
| A: LogP of 5-Aminoisatoic anhydride is 0.64470. |
| Q: What is the molecular formula of 5-Aminoisatoic anhydride? |
| A: Molecular formula of 5-Aminoisatoic anhydride is C8H6N2O3. |
| Q: What is the CAS number of 5-Aminoisatoic anhydride? |
| A: CAS number of 5-Aminoisatoic anhydride is 169037-24-5. |
| Q: What is the safety information for 5-Aminoisatoic anhydride? |
| A: Safety information for 5-Aminoisatoic anhydride: 26-36. |
| Q: What is the molecular weight of 5-Aminoisatoic anhydride? |
| A: Molecular weight of 5-Aminoisatoic anhydride is 178.14500. |
| Q: What is the melting point of 5-Aminoisatoic anhydride? |
| A: Melting point of 5-Aminoisatoic anhydride is >300ºC(lit.). |
| Q: What are the upstream materials of 5-Aminoisatoic anhydride? |
| A: Related upstream materials(CAS) of 5-Aminoisatoic anhydride: 4693-02-1. |
| Q: What is the English name of 5-Aminoisatoic anhydride? |
| A: The English name of 5-Aminoisatoic anhydride is 5-Aminoisatoic anhydride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |