2-hydroxy-3-phenoxypropyl methacrylate structure
|
Common Name | 2-hydroxy-3-phenoxypropyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 16926-87-7 | Molecular Weight | 236.26400 | |
| Density | 1.131g/cm3 | Boiling Point | 392ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | 2-hydroxy-3-phenoxypropyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 392ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 147.3ºC |
| Exact Mass | 236.10500 |
| PSA | 55.76000 |
| LogP | 1.54560 |
| Vapour Pressure | 7.58E-07mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | HFXVXHPSVLHXCC-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccccc1 |
| HS Code | 2916140000 |
|---|
|
~85%
2-hydroxy-3-phe... CAS#:16926-87-7 |
| Literature: Septodont Confi-Dental; Trujillo-Lemon, Marianela; Wall, Kristin Lindsay; Esquibel, Kristina; Boulden, Jordan; Docktor, Amy J.; Shelton, Zachary R.; Bracho-Troconis, Cora Patent: US8513326 B2, 2013 ; Location in patent: Page/Page column 30; 31 ; |
|
~93%
2-hydroxy-3-phe... CAS#:16926-87-7 |
| Literature: Tamami; Iranpoor; Rezaei Synthetic Communications, 2004 , vol. 34, # 15 p. 2789 - 2795 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| Methacrylic acid 2-hydroxy-3-phenoxypropyl ester |
| 2-Hydroxy-3-phenoxypropyl-methacrylat |
| 3-PHENOXY-2-HYDROXYPROPYL METHACRYLATE |
| 3-Phenoxy-2-hydroxypropyl methacryla |
| 2-Propenoicacid,2-methyl-,2-hydroxy-3-phenoxypropylester |
| 2,2'-DIHYDROXYAZOBENZENE |
| 2-methyl-2-propenoicaci2-hydroxy-3-phenoxypropylester |
| 3-O-Phenylglycerol 1-methacrylate |