1,5-Diphenyl-3-(4-methoxyphenyl)formazan structure
|
Common Name | 1,5-Diphenyl-3-(4-methoxyphenyl)formazan | ||
|---|---|---|---|---|
| CAS Number | 16929-09-2 | Molecular Weight | 330.383 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 474.3±47.0 °C at 760 mmHg | |
| Molecular Formula | C20H18N4O | Melting Point | 157ºC | |
| MSDS | N/A | Flash Point | 240.6±29.3 °C | |
| Name | 1,5-Diphenyl-3-(4-methoxyphenyl)formazan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 474.3±47.0 °C at 760 mmHg |
| Melting Point | 157ºC |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.383 |
| Flash Point | 240.6±29.3 °C |
| Exact Mass | 330.148071 |
| PSA | 58.34000 |
| LogP | 6.10 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | FKTMYMAIOJZZLV-KYZOMJKISA-N |
| SMILES | COc1ccc(C(N=Nc2ccccc2)=NNc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (E)-1-[(Z)-(4-Methoxyphenyl)(phenylhydrazono)methyl]-2-phenyldiazene |
| Diphenylmethoxyphenylformazan |
| Methanone, (4-methoxyphenyl)[(E)-2-phenyldiazenyl]-, 2-phenylhydrazone, (Z)- |
| 1,5-Diphenyl-3-<4-tolyloxy>-formazan |