1H-Pyrazole,3-(4-methoxyphenyl)-1,5-diphenyl- structure
|
Common Name | 1H-Pyrazole,3-(4-methoxyphenyl)-1,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 33045-40-8 | Molecular Weight | 326.39100 | |
| Density | 1.11g/cm3 | Boiling Point | 507.5ºC at 760mmHg | |
| Molecular Formula | C22H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.7ºC | |
| Name | 3-(4-methoxyphenyl)-1,5-diphenylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 507.5ºC at 760mmHg |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.39100 |
| Flash Point | 260.7ºC |
| Exact Mass | 326.14200 |
| PSA | 27.05000 |
| LogP | 5.21490 |
| Index of Refraction | 1.61 |
| InChIKey | XUFGQCLHXUUZNO-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-p-anisyl-1,5-diphenylpyrazole |