Boc-D-Leu-OH.H2O structure
|
Common Name | Boc-D-Leu-OH.H2O | ||
|---|---|---|---|---|
| CAS Number | 16937-99-8 | Molecular Weight | 231.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 356.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | 85-87ºC(lit.) | |
| MSDS | USA | Flash Point | 169.1±23.2 °C | |
Use of Boc-D-Leu-OH.H2O(tert-Butoxycarbonyl)-D-leucine is a leucine derivative[1]. |
| Name | Boc-D-Leucine monohydrate |
|---|---|
| Synonym | More Synonyms |
| Description | (tert-Butoxycarbonyl)-D-leucine is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.0±25.0 °C at 760 mmHg |
| Melting Point | 85-87ºC(lit.) |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.289 |
| Flash Point | 169.1±23.2 °C |
| Exact Mass | 231.147064 |
| PSA | 84.86000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | MDXGYYOJGPFFJL-MRVPVSSYSA-N |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | −20°C |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Transport and signaling via the amino acid binding site of the yeast Gap1 amino acid transceptor.
Nat. Chem. Biol. 5 , 45-52, (2009) Transporter-related nutrient sensors, called transceptors, mediate nutrient activation of signaling pathways through the plasma membrane. The mechanism of action of transporting and nontransporting tr... |
| MFCD00038294 |
| BOC-D-Leucinemonohydrate |
| Boc-D-Leu-OH&BOC-D-LEU |
| N-BOC-D-Leucine.H2O |
| Boc-D-Leu-OH Hydrate |
| N-(tert-Butoxycarbonyl)-D-leucine |
| D-Leucine, N-[(1,1-dimethylethoxy)carbonyl]-, hydrate (1:1) |
| BOC-D-LEUCINE-OH |
| N-T-BOC-D-LEUCINE |
| Boc-D-Leu-OH |
| N-(tert-Butoxycarbonyl)-D-leucine hydrate (1:1) |
| N-(tert-Butoxycarbonyl)-D-leucine Hydrate |
| BOC-D-LEU-OH2O |
| N-tert-butoxycarbonyl-D-leucine |
| n-boc-d-leucine |
| N-Boc-D-leucine Hydrate |
| D-Leucine, N-[(1,1-dimethylethoxy)carbonyl]- |
| tert-butoxycarbonyl-D-leucine |
| N-(t-butyloxycarbonyl)-D-leucine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-leucine hydrate (1:1) |
| Boc-D-Leu-OH.H2O |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-leucine |
| BOC-D-LEUCINE |
| Boc-(R)-leucine |