1-Chloro-2,3-difluoro-4-nitrobenzene structure
|
Common Name | 1-Chloro-2,3-difluoro-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 169468-80-8 | Molecular Weight | 193.535 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 251.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H2ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.7±25.9 °C | |
| Name | 1-Chloro-2,3-difluoro-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.2±35.0 °C at 760 mmHg |
| Molecular Formula | C6H2ClF2NO2 |
| Molecular Weight | 193.535 |
| Flash Point | 105.7±25.9 °C |
| Exact Mass | 192.974213 |
| PSA | 45.82000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | OFQRRFRIDGZHSC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-chloro-2,3-difluoro-4-nitro- |
| 1-Chloro-2,3-difluoro-4-nitrobenzene |
| MFCD06658265 |