Boc-cys(et)-oh structure
|
Common Name | Boc-cys(et)-oh | ||
|---|---|---|---|---|
| CAS Number | 16947-82-3 | Molecular Weight | 249.32700 | |
| Density | 1.16 g/cm3 | Boiling Point | 400.3ºC at 760 mmHg | |
| Molecular Formula | C10H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.9ºC | |
| Name | (2R)-3-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16 g/cm3 |
|---|---|
| Boiling Point | 400.3ºC at 760 mmHg |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.32700 |
| Flash Point | 195.9ºC |
| Exact Mass | 249.10300 |
| PSA | 100.93000 |
| LogP | 2.10830 |
| Vapour Pressure | 1.58E-07mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | IBCCMMVPGKVLAX-ZETCQYMHSA-N |
| SMILES | CCSCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2930909090 |
|---|
|
~%
Boc-cys(et)-oh CAS#:16947-82-3 |
| Literature: Bioorganic and medicinal chemistry letters, , vol. 14, # 1 p. 275 - 278 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-(S-ethyl)Cys-OH |
| Boc-Cys(Et)-Oh |
| N-Boc-S-ethyl-L-cysteine |
| MFCD00076919 |