Boc-Cys(pMeBzl)-OH structure
|
Common Name | Boc-Cys(pMeBzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 61925-77-7 | Molecular Weight | 325.423 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 493.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H23NO4S | Melting Point | 63-66ºC | |
| MSDS | USA | Flash Point | 252.4±28.7 °C | |
| Name | Boc-S-(4-Methylbenzyl)-L-Cysteine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.8±45.0 °C at 760 mmHg |
| Melting Point | 63-66ºC |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.423 |
| Flash Point | 252.4±28.7 °C |
| Exact Mass | 325.134766 |
| PSA | 100.93000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | CUNVVZWSABRKAL-ZDUSSCGKSA-N |
| SMILES | Cc1ccc(CSCC(NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~93%
Boc-Cys(pMeBzl)-OH CAS#:61925-77-7 |
| Literature: Shin; Inouye; Higuchi; Kyogoki Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 8 p. 2211 - 2215 |
|
~%
Boc-Cys(pMeBzl)-OH CAS#:61925-77-7 |
| Literature: Tetrahedron Letters, , vol. 35, # 11 p. 1631 - 1634 |
|
~%
Boc-Cys(pMeBzl)-OH CAS#:61925-77-7 |
| Literature: Tetrahedron Letters, , vol. 35, # 11 p. 1631 - 1634 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(tert-Butoxycarbonyl)-S-(4-methylbenzyl)-L-cysteine |
| MFCD00038517 |
| Boc-S-(4-methylbenzyl)-L-cysteine |
| S-(4-Methylbenzyl)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-cysteine |
| L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-[(4-methylphenyl)methyl]- |
| Boc-Cys(pMeBzl)-OH |