Boc-Lys(Tfa)-OH structure
|
Common Name | Boc-Lys(Tfa)-OH | ||
|---|---|---|---|---|
| CAS Number | 16965-06-3 | Molecular Weight | 342.311 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 485.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H21F3N2O5 | Melting Point | 102-105ºC | |
| MSDS | N/A | Flash Point | 247.5±28.7 °C | |
| Name | (S)-2-((tert-Butoxycarbonyl)amino)-6-(2,2,2-trifluoroacetamido)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.6±45.0 °C at 760 mmHg |
| Melting Point | 102-105ºC |
| Molecular Formula | C13H21F3N2O5 |
| Molecular Weight | 342.311 |
| Flash Point | 247.5±28.7 °C |
| Exact Mass | 342.140259 |
| PSA | 104.73000 |
| LogP | 1.56 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | DEIYNDIFGSDDCY-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)C(F)(F)F)C(=O)O |
| Storage condition | -15°C |
| Water Solubility | Soluble in DMSO. |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| L-Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-(2,2,2-trifluoroacetyl)- |
| N-(tert-Butoxycarbonyl)-N-(trifluoroacetyl)-L-lysine |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| MFCD00037104 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-N-(trifluoroacetyl)-L-lysine |
| Boc-Lys(Tfa)-OH |