4-Hydroxy-4-methylpiperidine-1-carboxylic acid benzyl ester structure
|
Common Name | 4-Hydroxy-4-methylpiperidine-1-carboxylic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 169750-57-6 | Molecular Weight | 249.30600 | |
| Density | 1.18g/cm3 | Boiling Point | 383.9ºC at 760mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | benzyl 4-hydroxy-4-methylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 383.9ºC at 760mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 186ºC |
| Exact Mass | 249.13600 |
| PSA | 49.77000 |
| LogP | 2.10790 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | JTYZJURNGHJWKI-UHFFFAOYSA-N |
| SMILES | CC1(O)CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Hydroxy-4-methylpiperidine-1-carboxylic acid benzyl ester |
| benzyl (4-hydroxy-4-methylpiperidin-1-yl)carboxylate |